C26H46Cl2N2O7S2Si — CID 158273093
dichloromethane;2-methoxyethyl 3-[(3-oxo-6-triethoxysilylhexyl)-[2-(pyridin-2-yldisulfanyl)ethyl]amino]propanoate (PubChem CID 158273093) has the molecular formula C26H46Cl2N2O7S2Si and a molecular weight of 661.79 g/mol. Its IUPAC name is dichloromethane;2-methoxyethyl 3-[(3-oxo-6-triethoxysilylhexyl)-[2-(pyridin-2-yldisulfanyl)ethyl]amino]propanoate.
| Compound Name | dichloromethane;2-methoxyethyl 3-[(3-oxo-6-triethoxysilylhexyl)-[2-(pyridin-2-yldisulfanyl)ethyl]amino]propanoate |
|---|---|
| PubChem CID | 158273093 |
| Molecular Formula | C26H46Cl2N2O7S2Si |
| Molecular Weight | 661.79 g/mol |
| Exact Mass | 660.19 |
| IUPAC Name | dichloromethane;2-methoxyethyl 3-[(3-oxo-6-triethoxysilylhexyl)-[2-(pyridin-2-yldisulfanyl)ethyl]amino]propanoate |
| SMILES | CCO[Si](CCCC(=O)CCN(CCSSc1ccccn1)CCC(=O)OCCOC)(OCC)OCC.ClCCl |
| InChI | InChI=1S/C25H44N2O7S2Si.CH2Cl2/c1-5-32-37(33-6-2,34-7-3)22-10-11-23(28)13-16-27(17-14-25(29)31-20-19-30-4)18-21-35-36-24-12-8-9-15-26-24;2-1-3/h8-9,12,15H,5-7,10-11,13-14,16-22H2,1-4H3;1H2 |
| InChIKey | GJHBGMYBYKOKIT-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 96.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.79 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|