C25H39N3O7S2 — CID 162036080
5-[2-[2-[[(2S)-2-ethyl-6-[3-(pyridin-2-yldisulfanyl)propanoylamino]hexanoyl]amino]ethoxy]ethoxy]-4-oxopentanoic acid (PubChem CID 162036080) has the molecular formula C25H39N3O7S2 and a molecular weight of 557.74 g/mol. Its IUPAC name is 5-[2-[2-[[(2S)-2-ethyl-6-[3-(pyridin-2-yldisulfanyl)propanoylamino]hexanoyl]amino]ethoxy]ethoxy]-4-oxopentanoic acid.
| Compound Name | 5-[2-[2-[[(2S)-2-ethyl-6-[3-(pyridin-2-yldisulfanyl)propanoylamino]hexanoyl]amino]ethoxy]ethoxy]-4-oxopentanoic acid |
|---|---|
| PubChem CID | 162036080 |
| Molecular Formula | C25H39N3O7S2 |
| Molecular Weight | 557.74 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | 5-[2-[2-[[(2S)-2-ethyl-6-[3-(pyridin-2-yldisulfanyl)propanoylamino]hexanoyl]amino]ethoxy]ethoxy]-4-oxopentanoic acid |
| SMILES | CC[C@@H](CCCCNC(=O)CCSSc1ccccn1)C(=O)NCCOCCOCC(=O)CCC(=O)O |
| InChI | InChI=1S/C25H39N3O7S2/c1-2-20(25(33)28-14-15-34-16-17-35-19-21(29)9-10-24(31)32)7-3-5-12-26-22(30)11-18-36-37-23-8-4-6-13-27-23/h4,6,8,13,20H,2-3,5,7,9-12,14-19H2,1H3,(H,26,30)(H,28,33)(H,31,32)/t20-/m0/s1 |
| InChIKey | ZQFIODQGKXQOPV-FQEVSTJZSA-N |
| XLogP | 3.11 |
| TPSA | 143.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.74 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|