C19H29NO5S5 — CID 132522487
2-[2-[2-[2-(pyridin-2-yldisulfanyl)ethoxy]ethoxy]ethoxy]ethyl 2-ethylsulfanylcarbothioylsulfanylpropanoate (PubChem CID 132522487) has the molecular formula C19H29NO5S5 and a molecular weight of 511.78 g/mol. Its IUPAC name is 2-[2-[2-[2-(pyridin-2-yldisulfanyl)ethoxy]ethoxy]ethoxy]ethyl 2-ethylsulfanylcarbothioylsulfanylpropanoate.
| Compound Name | 2-[2-[2-[2-(pyridin-2-yldisulfanyl)ethoxy]ethoxy]ethoxy]ethyl 2-ethylsulfanylcarbothioylsulfanylpropanoate |
|---|---|
| PubChem CID | 132522487 |
| Molecular Formula | C19H29NO5S5 |
| Molecular Weight | 511.78 g/mol |
| Exact Mass | 511.06 |
| IUPAC Name | 2-[2-[2-[2-(pyridin-2-yldisulfanyl)ethoxy]ethoxy]ethoxy]ethyl 2-ethylsulfanylcarbothioylsulfanylpropanoate |
| SMILES | CCSC(=S)SC(C)C(=O)OCCOCCOCCOCCSSc1ccccn1 |
| InChI | InChI=1S/C19H29NO5S5/c1-3-27-19(26)29-16(2)18(21)25-13-12-23-9-8-22-10-11-24-14-15-28-30-17-6-4-5-7-20-17/h4-7,16H,3,8-15H2,1-2H3 |
| InChIKey | HSLAIDRIYKIFEG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.78 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|