C31H50N2O3S2 — CID 138732250
(3-heptyl-1-oxopentadeca-9,12-dien-2-yl) N-methyl-N-[2-(pyridin-2-yldisulfanyl)ethyl]carbamate (PubChem CID 138732250) has the molecular formula C31H50N2O3S2 and a molecular weight of 562.89 g/mol. Its IUPAC name is (3-heptyl-1-oxopentadeca-9,12-dien-2-yl) N-methyl-N-[2-(pyridin-2-yldisulfanyl)ethyl]carbamate.
| Compound Name | (3-heptyl-1-oxopentadeca-9,12-dien-2-yl) N-methyl-N-[2-(pyridin-2-yldisulfanyl)ethyl]carbamate |
|---|---|
| PubChem CID | 138732250 |
| Molecular Formula | C31H50N2O3S2 |
| Molecular Weight | 562.89 g/mol |
| Exact Mass | 562.33 |
| IUPAC Name | (3-heptyl-1-oxopentadeca-9,12-dien-2-yl) N-methyl-N-[2-(pyridin-2-yldisulfanyl)ethyl]carbamate |
| SMILES | CCC=CCC=CCCCCCC(CCCCCCC)C(C=O)OC(=O)N(C)CCSSc1ccccn1 |
| InChI | InChI=1S/C31H50N2O3S2/c1-4-6-8-10-11-12-13-14-16-18-22-28(21-17-15-9-7-5-2)29(27-34)36-31(35)33(3)25-26-37-38-30-23-19-20-24-32-30/h6,8,11-12,19-20,23-24,27-29H,4-5,7,9-10,13-18,21-22,25-26H2,1-3H3 |
| InChIKey | FGSVFYGHLCTKCL-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.89 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|