C31H51NO3 — CID 175133266
3-(dimethylamino)-2-methyl-3-[(9Z,12Z)-octadeca-9,12-dienoxy]-4-phenylbutanoic acid (PubChem CID 175133266) has the molecular formula C31H51NO3 and a molecular weight of 485.75 g/mol. Its IUPAC name is 3-(dimethylamino)-2-methyl-3-[(9Z,12Z)-octadeca-9,12-dienoxy]-4-phenylbutanoic acid.
| Compound Name | 3-(dimethylamino)-2-methyl-3-[(9Z,12Z)-octadeca-9,12-dienoxy]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 175133266 |
| Molecular Formula | C31H51NO3 |
| Molecular Weight | 485.75 g/mol |
| Exact Mass | 485.39 |
| IUPAC Name | 3-(dimethylamino)-2-methyl-3-[(9Z,12Z)-octadeca-9,12-dienoxy]-4-phenylbutanoic acid |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC(Cc1ccccc1)(C(C)C(=O)O)N(C)C |
| InChI | InChI=1S/C31H51NO3/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23-26-35-31(32(3)4,28(2)30(33)34)27-29-24-21-20-22-25-29/h9-10,12-13,20-22,24-25,28H,5-8,11,14-19,23,26-27H2,1-4H3,(H,33,34)/b10-9-,13-12- |
| InChIKey | RJQRRZRXMRSXQF-UTJQPWESSA-N |
| XLogP | 8.04 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.75 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|