C12H12N2O13S — CID 18401347
bis(2,5-dioxopyrrolidin-1-yl) 2-hydroxy-3-sulfooxybutanedioate (PubChem CID 18401347) has the molecular formula C12H12N2O13S and a molecular weight of 424.30 g/mol. Its IUPAC name is bis(2,5-dioxopyrrolidin-1-yl) 2-hydroxy-3-sulfooxybutanedioate.
| Compound Name | bis(2,5-dioxopyrrolidin-1-yl) 2-hydroxy-3-sulfooxybutanedioate |
|---|---|
| PubChem CID | 18401347 |
| Molecular Formula | C12H12N2O13S |
| Molecular Weight | 424.30 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | bis(2,5-dioxopyrrolidin-1-yl) 2-hydroxy-3-sulfooxybutanedioate |
| SMILES | O=C(ON1C(=O)CCC1=O)C(O)C(OS(=O)(=O)O)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C12H12N2O13S/c15-5-1-2-6(16)13(5)25-11(20)9(19)10(27-28(22,23)24)12(21)26-14-7(17)3-4-8(14)18/h9-10,19H,1-4H2,(H,22,23,24) |
| InChIKey | MJZDQEDAVKGTBB-UHFFFAOYSA-N |
| XLogP | -3.25 |
| TPSA | 211.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.30 |
| LogP ≤ 5 | -3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|