C14H15NO7S — CID 89371565
(2,5-dioxopyrrolidin-1-yl) (2R)-2-(4-methylphenyl)sulfonyloxypropanoate (PubChem CID 89371565) has the molecular formula C14H15NO7S and a molecular weight of 341.34 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (2R)-2-(4-methylphenyl)sulfonyloxypropanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (2R)-2-(4-methylphenyl)sulfonyloxypropanoate |
|---|---|
| PubChem CID | 89371565 |
| Molecular Formula | C14H15NO7S |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (2R)-2-(4-methylphenyl)sulfonyloxypropanoate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H](C)C(=O)ON2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C14H15NO7S/c1-9-3-5-11(6-4-9)23(19,20)22-10(2)14(18)21-15-12(16)7-8-13(15)17/h3-6,10H,7-8H2,1-2H3/t10-/m1/s1 |
| InChIKey | DNMBZNHIJJUZOQ-SNVBAGLBSA-N |
| XLogP | 0.70 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|