C26H22N2O10S2 — CID 87855756
(1,3-dioxoisoindol-2-yl) 4-methylbenzenesulfonate;(2,5-dioxopyrrolidin-1-yl) 4-methylbenzenesulfonate (PubChem CID 87855756) has the molecular formula C26H22N2O10S2 and a molecular weight of 586.60 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl) 4-methylbenzenesulfonate;(2,5-dioxopyrrolidin-1-yl) 4-methylbenzenesulfonate.
| Compound Name | (1,3-dioxoisoindol-2-yl) 4-methylbenzenesulfonate;(2,5-dioxopyrrolidin-1-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87855756 |
| Molecular Formula | C26H22N2O10S2 |
| Molecular Weight | 586.60 g/mol |
| Exact Mass | 586.07 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl) 4-methylbenzenesulfonate;(2,5-dioxopyrrolidin-1-yl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)ON2C(=O)CCC2=O)cc1.Cc1ccc(S(=O)(=O)ON2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C15H11NO5S.C11H11NO5S/c1-10-6-8-11(9-7-10)22(19,20)21-16-14(17)12-4-2-3-5-13(12)15(16)18;1-8-2-4-9(5-3-8)18(15,16)17-12-10(13)6-7-11(12)14/h2-9H,1H3;2-5H,6-7H2,1H3 |
| InChIKey | QZKKVXRHRXJNOS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 161.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.60 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|