C25H25NO5S — CID 134358884
(5-hexyl-1,3-dioxobenzo[de]isoquinolin-2-yl) 4-methylbenzenesulfonate (PubChem CID 134358884) has the molecular formula C25H25NO5S and a molecular weight of 451.54 g/mol. Its IUPAC name is (5-hexyl-1,3-dioxobenzo[de]isoquinolin-2-yl) 4-methylbenzenesulfonate.
| Compound Name | (5-hexyl-1,3-dioxobenzo[de]isoquinolin-2-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134358884 |
| Molecular Formula | C25H25NO5S |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | (5-hexyl-1,3-dioxobenzo[de]isoquinolin-2-yl) 4-methylbenzenesulfonate |
| SMILES | CCCCCCc1cc2c3c(cccc3c1)C(=O)N(OS(=O)(=O)c1ccc(C)cc1)C2=O |
| InChI | InChI=1S/C25H25NO5S/c1-3-4-5-6-8-18-15-19-9-7-10-21-23(19)22(16-18)25(28)26(24(21)27)31-32(29,30)20-13-11-17(2)12-14-20/h7,9-16H,3-6,8H2,1-2H3 |
| InChIKey | NWINCGGVWUTVGI-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|