C16H13NO5S — CID 58621810
(4-methyl-1,3-dioxoisoindol-2-yl) 4-methylbenzenesulfonate (PubChem CID 58621810) has the molecular formula C16H13NO5S and a molecular weight of 331.35 g/mol. Its IUPAC name is (4-methyl-1,3-dioxoisoindol-2-yl) 4-methylbenzenesulfonate.
| Compound Name | (4-methyl-1,3-dioxoisoindol-2-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 58621810 |
| Molecular Formula | C16H13NO5S |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | (4-methyl-1,3-dioxoisoindol-2-yl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)ON2C(=O)c3cccc(C)c3C2=O)cc1 |
| InChI | InChI=1S/C16H13NO5S/c1-10-6-8-12(9-7-10)23(20,21)22-17-15(18)13-5-3-4-11(2)14(13)16(17)19/h3-9H,1-2H3 |
| InChIKey | AOAALKWPHXZIJR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|