C15H10FNO5S — CID 2133641
(1,3-dioxoisoindol-2-yl) 4-fluoro-2-methylbenzenesulfonate (PubChem CID 2133641) has the molecular formula C15H10FNO5S and a molecular weight of 335.31 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl) 4-fluoro-2-methylbenzenesulfonate.
| Compound Name | (1,3-dioxoisoindol-2-yl) 4-fluoro-2-methylbenzenesulfonate |
|---|---|
| PubChem CID | 2133641 |
| Molecular Formula | C15H10FNO5S |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl) 4-fluoro-2-methylbenzenesulfonate |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)ON1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H10FNO5S/c1-9-8-10(16)6-7-13(9)23(20,21)22-17-14(18)11-4-2-3-5-12(11)15(17)19/h2-8H,1H3 |
| InChIKey | KCBHYFBKDCBYEY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|