C12H10FNO5S — CID 20671175
(3,4-dimethyl-2,5-dioxopyrrol-1-yl) 4-fluorobenzenesulfonate (PubChem CID 20671175) has the molecular formula C12H10FNO5S and a molecular weight of 299.28 g/mol. Its IUPAC name is (3,4-dimethyl-2,5-dioxopyrrol-1-yl) 4-fluorobenzenesulfonate.
| Compound Name | (3,4-dimethyl-2,5-dioxopyrrol-1-yl) 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 20671175 |
| Molecular Formula | C12H10FNO5S |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | (3,4-dimethyl-2,5-dioxopyrrol-1-yl) 4-fluorobenzenesulfonate |
| SMILES | CC1=C(C)C(=O)N(OS(=O)(=O)c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C12H10FNO5S/c1-7-8(2)12(16)14(11(7)15)19-20(17,18)10-5-3-9(13)4-6-10/h3-6H,1-2H3 |
| InChIKey | NIYHPCRQBWHKEQ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|