C24H29NO5S — CID 139975695
(1,3-dioxoisoindol-2-yl) 4-decylbenzenesulfonate (PubChem CID 139975695) has the molecular formula C24H29NO5S and a molecular weight of 443.57 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl) 4-decylbenzenesulfonate.
| Compound Name | (1,3-dioxoisoindol-2-yl) 4-decylbenzenesulfonate |
|---|---|
| PubChem CID | 139975695 |
| Molecular Formula | C24H29NO5S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl) 4-decylbenzenesulfonate |
| SMILES | CCCCCCCCCCc1ccc(S(=O)(=O)ON2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C24H29NO5S/c1-2-3-4-5-6-7-8-9-12-19-15-17-20(18-16-19)31(28,29)30-25-23(26)21-13-10-11-14-22(21)24(25)27/h10-11,13-18H,2-9,12H2,1H3 |
| InChIKey | UJYTULGJLQXWFX-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|