C20H12F2N2O10S2 — CID 90892534
[9-(4-fluorophenyl)sulfonyloxy-3,5,8,10-tetrahydroxy-4,9-diazatricyclo[5.3.0.02,6]deca-1(10),2,5,7-tetraen-4-yl] 4-fluorobenzenesulfonate (PubChem CID 90892534) has the molecular formula C20H12F2N2O10S2 and a molecular weight of 542.45 g/mol. Its IUPAC name is [9-(4-fluorophenyl)sulfonyloxy-3,5,8,10-tetrahydroxy-4,9-diazatricyclo[5.3.0.02,6]deca-1(10),2,5,7-tetraen-4-yl] 4-fluorobenzenesulfonate.
| Compound Name | [9-(4-fluorophenyl)sulfonyloxy-3,5,8,10-tetrahydroxy-4,9-diazatricyclo[5.3.0.02,6]deca-1(10),2,5,7-tetraen-4-yl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 90892534 |
| Molecular Formula | C20H12F2N2O10S2 |
| Molecular Weight | 542.45 g/mol |
| Exact Mass | 541.99 |
| IUPAC Name | [9-(4-fluorophenyl)sulfonyloxy-3,5,8,10-tetrahydroxy-4,9-diazatricyclo[5.3.0.02,6]deca-1(10),2,5,7-tetraen-4-yl] 4-fluorobenzenesulfonate |
| SMILES | O=S(=O)(On1c(O)c2c(c1O)-c1c-2c(O)n(OS(=O)(=O)c2ccc(F)cc2)c1O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H12F2N2O10S2/c21-9-1-5-11(6-2-9)35(29,30)33-23-17(25)13-14(18(23)26)16-15(13)19(27)24(20(16)28)34-36(31,32)12-7-3-10(22)4-8-12/h1-8,25-28H |
| InChIKey | FSAUGYQGPDVWDP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 177.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.45 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |