About 2-hydroxyethyl 4-fluorobenzenesulfonate
2-hydroxyethyl 4-fluorobenzenesulfonate (PubChem CID 87089418) has the molecular formula C8H9FO4S
and a molecular weight of 220.22 g/mol. Its IUPAC name is 2-hydroxyethyl 4-fluorobenzenesulfonate.
Molecular Properties
| Compound Name | 2-hydroxyethyl 4-fluorobenzenesulfonate |
| PubChem CID | 87089418 |
| Molecular Formula | C8H9FO4S |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | 2-hydroxyethyl 4-fluorobenzenesulfonate |
| SMILES | O=S(=O)(OCCO)c1ccc(F)cc1 |
| InChI | InChI=1S/C8H9FO4S/c9-7-1-3-8(4-2-7)14(11,12)13-6-5-10/h1-4,10H,5-6H2 |
| InChIKey | XNZLSIIMUHGSCE-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl 4-fluorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl 4-fluorobenzenesulfonate?
The IUPAC name of 2-hydroxyethyl 4-fluorobenzenesulfonate (CID 87089418) is 2-hydroxyethyl 4-fluorobenzenesulfonate.
What is the SMILES notation for 2-hydroxyethyl 4-fluorobenzenesulfonate?
The canonical SMILES for 2-hydroxyethyl 4-fluorobenzenesulfonate is O=S(=O)(OCCO)c1ccc(F)cc1.
What is the InChIKey of 2-hydroxyethyl 4-fluorobenzenesulfonate?
The InChIKey is XNZLSIIMUHGSCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9FO4S/c9-7-1-3-8(4-2-7)14(11,12)13-6-5-10/h1-4,10H,5-6H2.
What are the key properties of 2-hydroxyethyl 4-fluorobenzenesulfonate?
2-hydroxyethyl 4-fluorobenzenesulfonate has a molecular weight of 220.22 g/mol, XLogP of 0.52, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 4-fluorobenzenesulfonate is sourced from PubChem (CID 87089418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).