About [3-(3-methoxy-3-methylbutoxy)-3-methylbutyl] 4-fluorobenzenesulfonate
[3-(3-methoxy-3-methylbutoxy)-3-methylbutyl] 4-fluorobenzenesulfonate (PubChem CID 142505105) has the molecular formula C17H27FO5S
and a molecular weight of 362.46 g/mol. Its IUPAC name is [3-(3-methoxy-3-methylbutoxy)-3-methylbutyl] 4-fluorobenzenesulfonate.
Molecular Properties
| Compound Name | [3-(3-methoxy-3-methylbutoxy)-3-methylbutyl] 4-fluorobenzenesulfonate |
| PubChem CID | 142505105 |
| Molecular Formula | C17H27FO5S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | [3-(3-methoxy-3-methylbutoxy)-3-methylbutyl] 4-fluorobenzenesulfonate |
| SMILES | COC(C)(C)CCOC(C)(C)CCOS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H27FO5S/c1-16(2,21-5)10-12-22-17(3,4)11-13-23-24(19,20)15-8-6-14(18)7-9-15/h6-9H,10-13H2,1-5H3 |
| InChIKey | ULWVYFSJWHMYCY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [3-(3-methoxy-3-methylbutoxy)-3-methylbutyl] 4-fluorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3-methoxy-3-methylbutoxy)-3-methylbutyl] 4-fluorobenzenesulfonate?
The IUPAC name of [3-(3-methoxy-3-methylbutoxy)-3-methylbutyl] 4-fluorobenzenesulfonate (CID 142505105) is [3-(3-methoxy-3-methylbutoxy)-3-methylbutyl] 4-fluorobenzenesulfonate.
What is the SMILES notation for [3-(3-methoxy-3-methylbutoxy)-3-methylbutyl] 4-fluorobenzenesulfonate?
The canonical SMILES for [3-(3-methoxy-3-methylbutoxy)-3-methylbutyl] 4-fluorobenzenesulfonate is COC(C)(C)CCOC(C)(C)CCOS(=O)(=O)c1ccc(F)cc1.
What is the InChIKey of [3-(3-methoxy-3-methylbutoxy)-3-methylbutyl] 4-fluorobenzenesulfonate?
The InChIKey is ULWVYFSJWHMYCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27FO5S/c1-16(2,21-5)10-12-22-17(3,4)11-13-23-24(19,20)15-8-6-14(18)7-9-15/h6-9H,10-13H2,1-5H3.
What are the key properties of [3-(3-methoxy-3-methylbutoxy)-3-methylbutyl] 4-fluorobenzenesulfonate?
[3-(3-methoxy-3-methylbutoxy)-3-methylbutyl] 4-fluorobenzenesulfonate has a molecular weight of 362.46 g/mol, XLogP of 3.53, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3-methoxy-3-methylbutoxy)-3-methylbutyl] 4-fluorobenzenesulfonate is sourced from PubChem (CID 142505105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).