C9H20O5S — CID 134602759
2-(3-methoxy-3-methylbutoxy)propane-2-sulfonic acid (PubChem CID 134602759) has the molecular formula C9H20O5S and a molecular weight of 240.32 g/mol. Its IUPAC name is 2-(3-methoxy-3-methylbutoxy)propane-2-sulfonic acid.
| Compound Name | 2-(3-methoxy-3-methylbutoxy)propane-2-sulfonic acid |
|---|---|
| PubChem CID | 134602759 |
| Molecular Formula | C9H20O5S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 2-(3-methoxy-3-methylbutoxy)propane-2-sulfonic acid |
| SMILES | COC(C)(C)CCOC(C)(C)S(=O)(=O)O |
| InChI | InChI=1S/C9H20O5S/c1-8(2,13-5)6-7-14-9(3,4)15(10,11)12/h6-7H2,1-5H3,(H,10,11,12) |
| InChIKey | JBUWRYBXJMWBEE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|