C10H8FNO5S — CID 54316839
(2,5-dihydroxypyrrol-1-yl) 4-fluorobenzenesulfonate (PubChem CID 54316839) has the molecular formula C10H8FNO5S and a molecular weight of 273.24 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4-fluorobenzenesulfonate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 54316839 |
| Molecular Formula | C10H8FNO5S |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.01 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4-fluorobenzenesulfonate |
| SMILES | O=S(=O)(On1c(O)ccc1O)c1ccc(F)cc1 |
| InChI | InChI=1S/C10H8FNO5S/c11-7-1-3-8(4-2-7)18(15,16)17-12-9(13)5-6-10(12)14/h1-6,13-14H |
| InChIKey | SOUUTVATKNBCGC-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |