C15H7Cl4NO5S — CID 20510480
(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl) 4-methylbenzenesulfonate (PubChem CID 20510480) has the molecular formula C15H7Cl4NO5S and a molecular weight of 455.10 g/mol. Its IUPAC name is (4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl) 4-methylbenzenesulfonate.
| Compound Name | (4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 20510480 |
| Molecular Formula | C15H7Cl4NO5S |
| Molecular Weight | 455.10 g/mol |
| Exact Mass | 452.88 |
| IUPAC Name | (4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)ON2C(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C2=O)cc1 |
| InChI | InChI=1S/C15H7Cl4NO5S/c1-6-2-4-7(5-3-6)26(23,24)25-20-14(21)8-9(15(20)22)11(17)13(19)12(18)10(8)16/h2-5H,1H3 |
| InChIKey | VPCVECHAKLNOFC-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.10 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|