C23H35NO5S — CID 58836407
(3,4-dihexyl-2,5-dioxopyrrolidin-1-yl) 4-methylbenzenesulfonate (PubChem CID 58836407) has the molecular formula C23H35NO5S and a molecular weight of 437.60 g/mol. Its IUPAC name is (3,4-dihexyl-2,5-dioxopyrrolidin-1-yl) 4-methylbenzenesulfonate.
| Compound Name | (3,4-dihexyl-2,5-dioxopyrrolidin-1-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 58836407 |
| Molecular Formula | C23H35NO5S |
| Molecular Weight | 437.60 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | (3,4-dihexyl-2,5-dioxopyrrolidin-1-yl) 4-methylbenzenesulfonate |
| SMILES | CCCCCCC1C(=O)N(OS(=O)(=O)c2ccc(C)cc2)C(=O)C1CCCCCC |
| InChI | InChI=1S/C23H35NO5S/c1-4-6-8-10-12-20-21(13-11-9-7-5-2)23(26)24(22(20)25)29-30(27,28)19-16-14-18(3)15-17-19/h14-17,20-21H,4-13H2,1-3H3 |
| InChIKey | MADWMIBINPMISH-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.60 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|