C16H19NO5S — CID 87854628
(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl) 4-methylbenzenesulfonate (PubChem CID 87854628) has the molecular formula C16H19NO5S and a molecular weight of 337.40 g/mol. Its IUPAC name is (5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl) 4-methylbenzenesulfonate.
| Compound Name | (5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87854628 |
| Molecular Formula | C16H19NO5S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | (5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)ON2C(=O)C3CCC(C)CC3C2=O)cc1 |
| InChI | InChI=1S/C16H19NO5S/c1-10-3-6-12(7-4-10)23(20,21)22-17-15(18)13-8-5-11(2)9-14(13)16(17)19/h3-4,6-7,11,13-14H,5,8-9H2,1-2H3 |
| InChIKey | FVTOCAIIMVKAKN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|