C16H15NO6S — CID 87652081
(3,5-dioxo-9-oxa-4-azatetracyclo[5.3.1.02,6.08,10]undecan-4-yl) 4-methylbenzenesulfonate (PubChem CID 87652081) has the molecular formula C16H15NO6S and a molecular weight of 349.36 g/mol. Its IUPAC name is (3,5-dioxo-9-oxa-4-azatetracyclo[5.3.1.02,6.08,10]undecan-4-yl) 4-methylbenzenesulfonate.
| Compound Name | (3,5-dioxo-9-oxa-4-azatetracyclo[5.3.1.02,6.08,10]undecan-4-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87652081 |
| Molecular Formula | C16H15NO6S |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | (3,5-dioxo-9-oxa-4-azatetracyclo[5.3.1.02,6.08,10]undecan-4-yl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)ON2C(=O)C3C4CC(C5OC45)C3C2=O)cc1 |
| InChI | InChI=1S/C16H15NO6S/c1-7-2-4-8(5-3-7)24(20,21)23-17-15(18)11-9-6-10(12(11)16(17)19)14-13(9)22-14/h2-5,9-14H,6H2,1H3 |
| InChIKey | TVUYWMZMBTWDRR-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 93.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|