C32H24N2O11S2 — CID 23023038
[5-[2-(2,5-dimethylphenyl)sulfonyloxy-1,3-dioxoisoindol-5-yl]oxy-1,3-dioxoisoindol-2-yl] 2,5-dimethylbenzenesulfonate (PubChem CID 23023038) has the molecular formula C32H24N2O11S2 and a molecular weight of 676.68 g/mol. Its IUPAC name is [5-[2-(2,5-dimethylphenyl)sulfonyloxy-1,3-dioxoisoindol-5-yl]oxy-1,3-dioxoisoindol-2-yl] 2,5-dimethylbenzenesulfonate.
| Compound Name | [5-[2-(2,5-dimethylphenyl)sulfonyloxy-1,3-dioxoisoindol-5-yl]oxy-1,3-dioxoisoindol-2-yl] 2,5-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 23023038 |
| Molecular Formula | C32H24N2O11S2 |
| Molecular Weight | 676.68 g/mol |
| Exact Mass | 676.08 |
| IUPAC Name | [5-[2-(2,5-dimethylphenyl)sulfonyloxy-1,3-dioxoisoindol-5-yl]oxy-1,3-dioxoisoindol-2-yl] 2,5-dimethylbenzenesulfonate |
| SMILES | Cc1ccc(C)c(S(=O)(=O)ON2C(=O)c3ccc(Oc4ccc5c(c4)C(=O)N(OS(=O)(=O)c4cc(C)ccc4C)C5=O)cc3C2=O)c1 |
| InChI | InChI=1S/C32H24N2O11S2/c1-17-5-7-19(3)27(13-17)46(39,40)44-33-29(35)23-11-9-21(15-25(23)31(33)37)43-22-10-12-24-26(16-22)32(38)34(30(24)36)45-47(41,42)28-14-18(2)6-8-20(28)4/h5-16H,1-4H3 |
| InChIKey | MEVCRWLMNOZWMQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 170.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.68 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|