About [5-(2-ethylsulfonyloxy-1,3-dioxoisoindol-5-yl)oxy-1,3-dioxoisoindol-2-yl] ethanesulfonate
[5-(2-ethylsulfonyloxy-1,3-dioxoisoindol-5-yl)oxy-1,3-dioxoisoindol-2-yl] ethanesulfonate (PubChem CID 23023046) has the molecular formula C20H16N2O11S2
and a molecular weight of 524.49 g/mol. Its IUPAC name is [5-(2-ethylsulfonyloxy-1,3-dioxoisoindol-5-yl)oxy-1,3-dioxoisoindol-2-yl] ethanesulfonate.
Molecular Properties
| Compound Name | [5-(2-ethylsulfonyloxy-1,3-dioxoisoindol-5-yl)oxy-1,3-dioxoisoindol-2-yl] ethanesulfonate |
| PubChem CID | 23023046 |
| Molecular Formula | C20H16N2O11S2 |
| Molecular Weight | 524.49 g/mol |
| Exact Mass | 524.02 |
| IUPAC Name | [5-(2-ethylsulfonyloxy-1,3-dioxoisoindol-5-yl)oxy-1,3-dioxoisoindol-2-yl] ethanesulfonate |
| SMILES | CCS(=O)(=O)ON1C(=O)c2ccc(Oc3ccc4c(c3)C(=O)N(OS(=O)(=O)CC)C4=O)cc2C1=O |
| InChI | InChI=1S/C20H16N2O11S2/c1-3-34(27,28)32-21-17(23)13-7-5-11(9-15(13)19(21)25)31-12-6-8-14-16(10-12)20(26)22(18(14)24)33-35(29,30)4-2/h5-10H,3-4H2,1-2H3 |
| InChIKey | ADHRQWZSDVIKCK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 170.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 524.49 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [5-(2-ethylsulfonyloxy-1,3-dioxoisoindol-5-yl)oxy-1,3-dioxoisoindol-2-yl] ethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2-ethylsulfonyloxy-1,3-dioxoisoindol-5-yl)oxy-1,3-dioxoisoindol-2-yl] ethanesulfonate?
The IUPAC name of [5-(2-ethylsulfonyloxy-1,3-dioxoisoindol-5-yl)oxy-1,3-dioxoisoindol-2-yl] ethanesulfonate (CID 23023046) is [5-(2-ethylsulfonyloxy-1,3-dioxoisoindol-5-yl)oxy-1,3-dioxoisoindol-2-yl] ethanesulfonate.
What is the SMILES notation for [5-(2-ethylsulfonyloxy-1,3-dioxoisoindol-5-yl)oxy-1,3-dioxoisoindol-2-yl] ethanesulfonate?
The canonical SMILES for [5-(2-ethylsulfonyloxy-1,3-dioxoisoindol-5-yl)oxy-1,3-dioxoisoindol-2-yl] ethanesulfonate is CCS(=O)(=O)ON1C(=O)c2ccc(Oc3ccc4c(c3)C(=O)N(OS(=O)(=O)CC)C4=O)cc2C1=O.
What is the InChIKey of [5-(2-ethylsulfonyloxy-1,3-dioxoisoindol-5-yl)oxy-1,3-dioxoisoindol-2-yl] ethanesulfonate?
The InChIKey is ADHRQWZSDVIKCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N2O11S2/c1-3-34(27,28)32-21-17(23)13-7-5-11(9-15(13)19(21)25)31-12-6-8-14-16(10-12)20(26)22(18(14)24)33-35(29,30)4-2/h5-10H,3-4H2,1-2H3.
What are the key properties of [5-(2-ethylsulfonyloxy-1,3-dioxoisoindol-5-yl)oxy-1,3-dioxoisoindol-2-yl] ethanesulfonate?
[5-(2-ethylsulfonyloxy-1,3-dioxoisoindol-5-yl)oxy-1,3-dioxoisoindol-2-yl] ethanesulfonate has a molecular weight of 524.49 g/mol, XLogP of 1.23, 8 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2-ethylsulfonyloxy-1,3-dioxoisoindol-5-yl)oxy-1,3-dioxoisoindol-2-yl] ethanesulfonate is sourced from PubChem (CID 23023046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).