C18H18N2O3 — CID 8545276
5-(4-aminophenoxy)-2-(2-methylpropyl)isoindole-1,3-dione (PubChem CID 8545276) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is 5-(4-aminophenoxy)-2-(2-methylpropyl)isoindole-1,3-dione.
| Compound Name | 5-(4-aminophenoxy)-2-(2-methylpropyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 8545276 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 5-(4-aminophenoxy)-2-(2-methylpropyl)isoindole-1,3-dione |
| SMILES | CC(C)CN1C(=O)c2ccc(Oc3ccc(N)cc3)cc2C1=O |
| InChI | InChI=1S/C18H18N2O3/c1-11(2)10-20-17(21)15-8-7-14(9-16(15)18(20)22)23-13-5-3-12(19)4-6-13/h3-9,11H,10,19H2,1-2H3 |
| InChIKey | FFIOJVRTXVDYQC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|