C30H24N2O10 — CID 5210469
2-[5-[4-[2-(2-acetyloxyethyl)-1,3-dioxoisoindol-5-yl]oxyphenoxy]-1,3-dioxoisoindol-2-yl]ethyl acetate (PubChem CID 5210469) has the molecular formula C30H24N2O10 and a molecular weight of 572.53 g/mol. Its IUPAC name is 2-[5-[4-[2-(2-acetyloxyethyl)-1,3-dioxoisoindol-5-yl]oxyphenoxy]-1,3-dioxoisoindol-2-yl]ethyl acetate.
| Compound Name | 2-[5-[4-[2-(2-acetyloxyethyl)-1,3-dioxoisoindol-5-yl]oxyphenoxy]-1,3-dioxoisoindol-2-yl]ethyl acetate |
|---|---|
| PubChem CID | 5210469 |
| Molecular Formula | C30H24N2O10 |
| Molecular Weight | 572.53 g/mol |
| Exact Mass | 572.14 |
| IUPAC Name | 2-[5-[4-[2-(2-acetyloxyethyl)-1,3-dioxoisoindol-5-yl]oxyphenoxy]-1,3-dioxoisoindol-2-yl]ethyl acetate |
| SMILES | CC(=O)OCCN1C(=O)c2ccc(Oc3ccc(Oc4ccc5c(c4)C(=O)N(CCOC(C)=O)C5=O)cc3)cc2C1=O |
| InChI | InChI=1S/C30H24N2O10/c1-17(33)39-13-11-31-27(35)23-9-7-21(15-25(23)29(31)37)41-19-3-5-20(6-4-19)42-22-8-10-24-26(16-22)30(38)32(28(24)36)12-14-40-18(2)34/h3-10,15-16H,11-14H2,1-2H3 |
| InChIKey | WYECGCBLZKAMQB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 145.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|