C19H16N2O7 — CID 2264146
3-[5-(4-nitrophenoxy)-1,3-dioxoisoindol-2-yl]propyl acetate (PubChem CID 2264146) has the molecular formula C19H16N2O7 and a molecular weight of 384.34 g/mol. Its IUPAC name is 3-[5-(4-nitrophenoxy)-1,3-dioxoisoindol-2-yl]propyl acetate.
| Compound Name | 3-[5-(4-nitrophenoxy)-1,3-dioxoisoindol-2-yl]propyl acetate |
|---|---|
| PubChem CID | 2264146 |
| Molecular Formula | C19H16N2O7 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 3-[5-(4-nitrophenoxy)-1,3-dioxoisoindol-2-yl]propyl acetate |
| SMILES | CC(=O)OCCCN1C(=O)c2ccc(Oc3ccc([N+](=O)[O-])cc3)cc2C1=O |
| InChI | InChI=1S/C19H16N2O7/c1-12(22)27-10-2-9-20-18(23)16-8-7-15(11-17(16)19(20)24)28-14-5-3-13(4-6-14)21(25)26/h3-8,11H,2,9-10H2,1H3 |
| InChIKey | IXMJKOWERUQJNA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|