C15H17N3O7 — CID 70470124
3-[5-(2-acetamidoethoxy)-1,3-dioxoisoindol-2-yl]propyl nitrate (PubChem CID 70470124) has the molecular formula C15H17N3O7 and a molecular weight of 351.32 g/mol. Its IUPAC name is 3-[5-(2-acetamidoethoxy)-1,3-dioxoisoindol-2-yl]propyl nitrate.
| Compound Name | 3-[5-(2-acetamidoethoxy)-1,3-dioxoisoindol-2-yl]propyl nitrate |
|---|---|
| PubChem CID | 70470124 |
| Molecular Formula | C15H17N3O7 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 3-[5-(2-acetamidoethoxy)-1,3-dioxoisoindol-2-yl]propyl nitrate |
| SMILES | CC(=O)NCCOc1ccc2c(c1)C(=O)N(CCCO[N+](=O)[O-])C2=O |
| InChI | InChI=1S/C15H17N3O7/c1-10(19)16-5-8-24-11-3-4-12-13(9-11)15(21)17(14(12)20)6-2-7-25-18(22)23/h3-4,9H,2,5-8H2,1H3,(H,16,19) |
| InChIKey | TXNOWTHDAYCTKF-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|