C19H27N3O6 — CID 70470775
4-[5-[1-(methylamino)hexoxy]-1,3-dioxoisoindol-2-yl]butyl nitrate (PubChem CID 70470775) has the molecular formula C19H27N3O6 and a molecular weight of 393.44 g/mol. Its IUPAC name is 4-[5-[1-(methylamino)hexoxy]-1,3-dioxoisoindol-2-yl]butyl nitrate.
| Compound Name | 4-[5-[1-(methylamino)hexoxy]-1,3-dioxoisoindol-2-yl]butyl nitrate |
|---|---|
| PubChem CID | 70470775 |
| Molecular Formula | C19H27N3O6 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 4-[5-[1-(methylamino)hexoxy]-1,3-dioxoisoindol-2-yl]butyl nitrate |
| SMILES | CCCCCC(NC)Oc1ccc2c(c1)C(=O)N(CCCCO[N+](=O)[O-])C2=O |
| InChI | InChI=1S/C19H27N3O6/c1-3-4-5-8-17(20-2)28-14-9-10-15-16(13-14)19(24)21(18(15)23)11-6-7-12-27-22(25)26/h9-10,13,17,20H,3-8,11-12H2,1-2H3 |
| InChIKey | ADGHFINQAJGNFK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|