C24H23N3O7 — CID 90278435
6-[5-(2-methyl-1,3-dioxoisoindol-5-yl)oxy-1,3-dioxoisoindol-2-yl]hexylcarbamic acid (PubChem CID 90278435) has the molecular formula C24H23N3O7 and a molecular weight of 465.46 g/mol. Its IUPAC name is 6-[5-(2-methyl-1,3-dioxoisoindol-5-yl)oxy-1,3-dioxoisoindol-2-yl]hexylcarbamic acid.
| Compound Name | 6-[5-(2-methyl-1,3-dioxoisoindol-5-yl)oxy-1,3-dioxoisoindol-2-yl]hexylcarbamic acid |
|---|---|
| PubChem CID | 90278435 |
| Molecular Formula | C24H23N3O7 |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 6-[5-(2-methyl-1,3-dioxoisoindol-5-yl)oxy-1,3-dioxoisoindol-2-yl]hexylcarbamic acid |
| SMILES | CN1C(=O)c2ccc(Oc3ccc4c(c3)C(=O)N(CCCCCCNC(=O)O)C4=O)cc2C1=O |
| InChI | InChI=1S/C24H23N3O7/c1-26-20(28)16-8-6-14(12-18(16)21(26)29)34-15-7-9-17-19(13-15)23(31)27(22(17)30)11-5-3-2-4-10-25-24(32)33/h6-9,12-13,25H,2-5,10-11H2,1H3,(H,32,33) |
| InChIKey | UQNVCGWZJDQJBO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|