C24H28N2O6Si2 — CID 58692154
5-[2-[[[ethyl(dimethyl)silyl]oxy-dimethylsilyl]methyl]-1,3-dioxoisoindol-5-yl]oxy-2-methylisoindole-1,3-dione (PubChem CID 58692154) has the molecular formula C24H28N2O6Si2 and a molecular weight of 496.67 g/mol. Its IUPAC name is 5-[2-[[[ethyl(dimethyl)silyl]oxy-dimethylsilyl]methyl]-1,3-dioxoisoindol-5-yl]oxy-2-methylisoindole-1,3-dione.
| Compound Name | 5-[2-[[[ethyl(dimethyl)silyl]oxy-dimethylsilyl]methyl]-1,3-dioxoisoindol-5-yl]oxy-2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 58692154 |
| Molecular Formula | C24H28N2O6Si2 |
| Molecular Weight | 496.67 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 5-[2-[[[ethyl(dimethyl)silyl]oxy-dimethylsilyl]methyl]-1,3-dioxoisoindol-5-yl]oxy-2-methylisoindole-1,3-dione |
| SMILES | CC[Si](C)(C)O[Si](C)(C)CN1C(=O)c2ccc(Oc3ccc4c(c3)C(=O)N(C)C4=O)cc2C1=O |
| InChI | InChI=1S/C24H28N2O6Si2/c1-7-33(3,4)32-34(5,6)14-26-23(29)18-11-9-16(13-20(18)24(26)30)31-15-8-10-17-19(12-15)22(28)25(2)21(17)27/h8-13H,7,14H2,1-6H3 |
| InChIKey | JQAAKCQFVTTYOI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.67 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|