C68H94N2O6 — CID 164805823
5-[4-[2-[4-[2-[8-(3-hexyl-2,6-dioctylcyclohexyl)octyl]-1,3-dioxoisoindol-5-yl]oxyphenyl]propan-2-yl]phenoxy]-2-methylisoindole-1,3-dione (PubChem CID 164805823) has the molecular formula C68H94N2O6 and a molecular weight of 1035.51 g/mol. Its IUPAC name is 5-[4-[2-[4-[2-[8-(3-hexyl-2,6-dioctylcyclohexyl)octyl]-1,3-dioxoisoindol-5-yl]oxyphenyl]propan-2-yl]phenoxy]-2-methylisoindole-1,3-dione.
| Compound Name | 5-[4-[2-[4-[2-[8-(3-hexyl-2,6-dioctylcyclohexyl)octyl]-1,3-dioxoisoindol-5-yl]oxyphenyl]propan-2-yl]phenoxy]-2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 164805823 |
| Molecular Formula | C68H94N2O6 |
| Molecular Weight | 1035.51 g/mol |
| Exact Mass | 1034.71 |
| IUPAC Name | 5-[4-[2-[4-[2-[8-(3-hexyl-2,6-dioctylcyclohexyl)octyl]-1,3-dioxoisoindol-5-yl]oxyphenyl]propan-2-yl]phenoxy]-2-methylisoindole-1,3-dione |
| SMILES | CCCCCCCCC1CCC(CCCCCC)C(CCCCCCCC)C1CCCCCCCCN1C(=O)c2ccc(Oc3ccc(C(C)(C)c4ccc(Oc5ccc6c(c5)C(=O)N(C)C6=O)cc4)cc3)cc2C1=O |
| InChI | InChI=1S/C68H94N2O6/c1-7-10-13-16-20-25-30-51-34-33-50(29-24-15-12-9-3)58(31-26-21-17-14-11-8-2)59(51)32-27-22-18-19-23-28-47-70-66(73)61-46-44-57(49-63(61)67(70)74)76-55-41-37-53(38-42-55)68(4,5)52-35-39-54(40-36-52)75-56-43-45-60-62(48-56)65(72)69(6)64(60)71/h35-46,48-51,58-59H,7-34,47H2,1-6H3 |
| InChIKey | XVNWNSYGXSGXCU-UHFFFAOYSA-N |
| XLogP | 18.88 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1035.51 |
| LogP ≤ 5 | 18.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|