C33H26N2O6 — CID 140936134
2-methyl-5-[4-[2-[4-(2-methyl-1,3-dioxoisoindol-5-yl)oxyphenyl]propyl]phenoxy]isoindole-1,3-dione (PubChem CID 140936134) has the molecular formula C33H26N2O6 and a molecular weight of 546.58 g/mol. Its IUPAC name is 2-methyl-5-[4-[2-[4-(2-methyl-1,3-dioxoisoindol-5-yl)oxyphenyl]propyl]phenoxy]isoindole-1,3-dione.
| Compound Name | 2-methyl-5-[4-[2-[4-(2-methyl-1,3-dioxoisoindol-5-yl)oxyphenyl]propyl]phenoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 140936134 |
| Molecular Formula | C33H26N2O6 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | 2-methyl-5-[4-[2-[4-(2-methyl-1,3-dioxoisoindol-5-yl)oxyphenyl]propyl]phenoxy]isoindole-1,3-dione |
| SMILES | CC(Cc1ccc(Oc2ccc3c(c2)C(=O)N(C)C3=O)cc1)c1ccc(Oc2ccc3c(c2)C(=O)N(C)C3=O)cc1 |
| InChI | InChI=1S/C33H26N2O6/c1-19(21-6-10-23(11-7-21)41-25-13-15-27-29(18-25)33(39)35(3)31(27)37)16-20-4-8-22(9-5-20)40-24-12-14-26-28(17-24)32(38)34(2)30(26)36/h4-15,17-19H,16H2,1-3H3 |
| InChIKey | HLAYTWXJCBEDRS-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|