C23H16NO7- — CID 4081510
3-[4-[2-(2-hydroxyethyl)-1,3-dioxoisoindol-5-yl]oxyphenoxy]benzoate (PubChem CID 4081510) has the molecular formula C23H16NO7- and a molecular weight of 418.38 g/mol. Its IUPAC name is 3-[4-[2-(2-hydroxyethyl)-1,3-dioxoisoindol-5-yl]oxyphenoxy]benzoate.
| Compound Name | 3-[4-[2-(2-hydroxyethyl)-1,3-dioxoisoindol-5-yl]oxyphenoxy]benzoate |
|---|---|
| PubChem CID | 4081510 |
| Molecular Formula | C23H16NO7- |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 3-[4-[2-(2-hydroxyethyl)-1,3-dioxoisoindol-5-yl]oxyphenoxy]benzoate |
| SMILES | O=C([O-])c1cccc(Oc2ccc(Oc3ccc4c(c3)C(=O)N(CCO)C4=O)cc2)c1 |
| InChI | InChI=1S/C23H17NO7/c25-11-10-24-21(26)19-9-8-18(13-20(19)22(24)27)31-16-6-4-15(5-7-16)30-17-3-1-2-14(12-17)23(28)29/h1-9,12-13,25H,10-11H2,(H,28,29)/p-1 |
| InChIKey | FCSSKMQJJMQJBX-UHFFFAOYSA-M |
| XLogP | 2.22 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|