C10H8ClNO3 — CID 13321636
5-chloro-2-(2-hydroxyethyl)isoindole-1,3-dione (PubChem CID 13321636) has the molecular formula C10H8ClNO3 and a molecular weight of 225.63 g/mol. Its IUPAC name is 5-chloro-2-(2-hydroxyethyl)isoindole-1,3-dione.
| Compound Name | 5-chloro-2-(2-hydroxyethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 13321636 |
| Molecular Formula | C10H8ClNO3 |
| Molecular Weight | 225.63 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | 5-chloro-2-(2-hydroxyethyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccc(Cl)cc2C(=O)N1CCO |
| InChI | InChI=1S/C10H8ClNO3/c11-6-1-2-7-8(5-6)10(15)12(3-4-13)9(7)14/h1-2,5,13H,3-4H2 |
| InChIKey | WGFBIMKHOTXNPG-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.63 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|