C13H11NO3 — CID 67477607
2-(2-hydroxyethyl)-5-prop-1-ynylisoindole-1,3-dione (PubChem CID 67477607) has the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. Its IUPAC name is 2-(2-hydroxyethyl)-5-prop-1-ynylisoindole-1,3-dione.
| Compound Name | 2-(2-hydroxyethyl)-5-prop-1-ynylisoindole-1,3-dione |
|---|---|
| PubChem CID | 67477607 |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 2-(2-hydroxyethyl)-5-prop-1-ynylisoindole-1,3-dione |
| SMILES | CC#Cc1ccc2c(c1)C(=O)N(CCO)C2=O |
| InChI | InChI=1S/C13H11NO3/c1-2-3-9-4-5-10-11(8-9)13(17)14(6-7-15)12(10)16/h4-5,8,15H,6-7H2,1H3 |
| InChIKey | COAWAVXMOVCXEY-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|