C15H13NO4 — CID 67477596
4-(1,3-dioxo-5-prop-1-ynylisoindol-2-yl)butanoic acid (PubChem CID 67477596) has the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. Its IUPAC name is 4-(1,3-dioxo-5-prop-1-ynylisoindol-2-yl)butanoic acid.
| Compound Name | 4-(1,3-dioxo-5-prop-1-ynylisoindol-2-yl)butanoic acid |
|---|---|
| PubChem CID | 67477596 |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 4-(1,3-dioxo-5-prop-1-ynylisoindol-2-yl)butanoic acid |
| SMILES | CC#Cc1ccc2c(c1)C(=O)N(CCCC(=O)O)C2=O |
| InChI | InChI=1S/C15H13NO4/c1-2-4-10-6-7-11-12(9-10)15(20)16(14(11)19)8-3-5-13(17)18/h6-7,9H,3,5,8H2,1H3,(H,17,18) |
| InChIKey | KFXJGXLUIGEITB-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|