C44H35N3O16 — CID 158079244
4-aminobutanoic acid;4-[5-[2-(3-carboxypropyl)-1,3-dioxoisoindol-5-yl]-1,3-dioxoisoindol-2-yl]butanoic acid;5-(1,3-dioxo-2-benzofuran-5-yl)-2-benzofuran-1,3-dione (PubChem CID 158079244) has the molecular formula C44H35N3O16 and a molecular weight of 861.77 g/mol. Its IUPAC name is 4-aminobutanoic acid;4-[5-[2-(3-carboxypropyl)-1,3-dioxoisoindol-5-yl]-1,3-dioxoisoindol-2-yl]butanoic acid;5-(1,3-dioxo-2-benzofuran-5-yl)-2-benzofuran-1,3-dione.
| Compound Name | 4-aminobutanoic acid;4-[5-[2-(3-carboxypropyl)-1,3-dioxoisoindol-5-yl]-1,3-dioxoisoindol-2-yl]butanoic acid;5-(1,3-dioxo-2-benzofuran-5-yl)-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 158079244 |
| Molecular Formula | C44H35N3O16 |
| Molecular Weight | 861.77 g/mol |
| Exact Mass | 861.20 |
| IUPAC Name | 4-aminobutanoic acid;4-[5-[2-(3-carboxypropyl)-1,3-dioxoisoindol-5-yl]-1,3-dioxoisoindol-2-yl]butanoic acid;5-(1,3-dioxo-2-benzofuran-5-yl)-2-benzofuran-1,3-dione |
| SMILES | NCCCC(=O)O.O=C(O)CCCN1C(=O)c2ccc(-c3ccc4c(c3)C(=O)N(CCCC(=O)O)C4=O)cc2C1=O.O=C1OC(=O)c2cc(-c3ccc4c(c3)C(=O)OC4=O)ccc21 |
| InChI | InChI=1S/C24H20N2O8.C16H6O6.C4H9NO2/c27-19(28)3-1-9-25-21(31)15-7-5-13(11-17(15)23(25)33)14-6-8-16-18(12-14)24(34)26(22(16)32)10-2-4-20(29)30;17-13-9-3-1-7(5-11(9)15(19)21-13)8-2-4-10-12(6-8)16(20)22-14(10)18;5-3-1-2-4(6)7/h5-8,11-12H,1-4,9-10H2,(H,27,28)(H,29,30);1-6H;1-3,5H2,(H,6,7) |
| InChIKey | FMTAUAXAYQPOPA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 299.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.77 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|