C22H20N2O7 — CID 130374706
2-(2-hydroxyethyl)-5-[(Z)-4-[1-(2-hydroxyethyl)-4-methyl-2,5-dioxopyrrol-3-yl]-2-methylidenebut-3-enoyl]isoindole-1,3-dione (PubChem CID 130374706) has the molecular formula C22H20N2O7 and a molecular weight of 424.41 g/mol. Its IUPAC name is 2-(2-hydroxyethyl)-5-[(Z)-4-[1-(2-hydroxyethyl)-4-methyl-2,5-dioxopyrrol-3-yl]-2-methylidenebut-3-enoyl]isoindole-1,3-dione.
| Compound Name | 2-(2-hydroxyethyl)-5-[(Z)-4-[1-(2-hydroxyethyl)-4-methyl-2,5-dioxopyrrol-3-yl]-2-methylidenebut-3-enoyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 130374706 |
| Molecular Formula | C22H20N2O7 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 2-(2-hydroxyethyl)-5-[(Z)-4-[1-(2-hydroxyethyl)-4-methyl-2,5-dioxopyrrol-3-yl]-2-methylidenebut-3-enoyl]isoindole-1,3-dione |
| SMILES | C=C(/C=C\C1=C(C)C(=O)N(CCO)C1=O)C(=O)c1ccc2c(c1)C(=O)N(CCO)C2=O |
| InChI | InChI=1S/C22H20N2O7/c1-12(3-5-15-13(2)19(28)23(7-9-25)20(15)29)18(27)14-4-6-16-17(11-14)22(31)24(8-10-26)21(16)30/h3-6,11,25-26H,1,7-10H2,2H3/b5-3- |
| InChIKey | WERDXNJKVSCLRH-HYXAFXHYSA-N |
| XLogP | 0.25 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|