C19H17Cl2N3O3 — CID 27160971
N-(4-amino-3,5-dichlorophenyl)-2-butyl-1,3-dioxoisoindole-5-carboxamide (PubChem CID 27160971) has the molecular formula C19H17Cl2N3O3 and a molecular weight of 406.27 g/mol. Its IUPAC name is N-(4-amino-3,5-dichlorophenyl)-2-butyl-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-(4-amino-3,5-dichlorophenyl)-2-butyl-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 27160971 |
| Molecular Formula | C19H17Cl2N3O3 |
| Molecular Weight | 406.27 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | N-(4-amino-3,5-dichlorophenyl)-2-butyl-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CCCCN1C(=O)c2ccc(C(=O)Nc3cc(Cl)c(N)c(Cl)c3)cc2C1=O |
| InChI | InChI=1S/C19H17Cl2N3O3/c1-2-3-6-24-18(26)12-5-4-10(7-13(12)19(24)27)17(25)23-11-8-14(20)16(22)15(21)9-11/h4-5,7-9H,2-3,6,22H2,1H3,(H,23,25) |
| InChIKey | PEOYCRBPOFNYMH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.27 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|