C24H21N3O4S — CID 31520702
2-butyl-1,3-dioxo-N-[3-(thiophene-2-carbonylamino)phenyl]isoindole-5-carboxamide (PubChem CID 31520702) has the molecular formula C24H21N3O4S and a molecular weight of 447.52 g/mol. Its IUPAC name is 2-butyl-1,3-dioxo-N-[3-(thiophene-2-carbonylamino)phenyl]isoindole-5-carboxamide.
| Compound Name | 2-butyl-1,3-dioxo-N-[3-(thiophene-2-carbonylamino)phenyl]isoindole-5-carboxamide |
|---|---|
| PubChem CID | 31520702 |
| Molecular Formula | C24H21N3O4S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 2-butyl-1,3-dioxo-N-[3-(thiophene-2-carbonylamino)phenyl]isoindole-5-carboxamide |
| SMILES | CCCCN1C(=O)c2ccc(C(=O)Nc3cccc(NC(=O)c4cccs4)c3)cc2C1=O |
| InChI | InChI=1S/C24H21N3O4S/c1-2-3-11-27-23(30)18-10-9-15(13-19(18)24(27)31)21(28)25-16-6-4-7-17(14-16)26-22(29)20-8-5-12-32-20/h4-10,12-14H,2-3,11H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | CSGNZIBOTAHNCW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|