About 2-butyl-1,3-dioxo-N-(5-thiophen-2-yl-1H-pyrazol-3-yl)isoindole-5-carboxamide
2-butyl-1,3-dioxo-N-(5-thiophen-2-yl-1H-pyrazol-3-yl)isoindole-5-carboxamide (PubChem CID 52719410) has the molecular formula C20H18N4O3S
and a molecular weight of 394.46 g/mol. Its IUPAC name is 2-butyl-1,3-dioxo-N-(5-thiophen-2-yl-1H-pyrazol-3-yl)isoindole-5-carboxamide.
Molecular Properties
| Compound Name | 2-butyl-1,3-dioxo-N-(5-thiophen-2-yl-1H-pyrazol-3-yl)isoindole-5-carboxamide |
| PubChem CID | 52719410 |
| Molecular Formula | C20H18N4O3S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 2-butyl-1,3-dioxo-N-(5-thiophen-2-yl-1H-pyrazol-3-yl)isoindole-5-carboxamide |
| SMILES | CCCCN1C(=O)c2ccc(C(=O)Nc3cc(-c4cccs4)[nH]n3)cc2C1=O |
| InChI | InChI=1S/C20H18N4O3S/c1-2-3-8-24-19(26)13-7-6-12(10-14(13)20(24)27)18(25)21-17-11-15(22-23-17)16-5-4-9-28-16/h4-7,9-11H,2-3,8H2,1H3,(H2,21,22,23,25) |
| InChIKey | HGUMHEXXETYZHC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-butyl-1,3-dioxo-N-(5-thiophen-2-yl-1H-pyrazol-3-yl)isoindole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-1,3-dioxo-N-(5-thiophen-2-yl-1H-pyrazol-3-yl)isoindole-5-carboxamide?
The IUPAC name of 2-butyl-1,3-dioxo-N-(5-thiophen-2-yl-1H-pyrazol-3-yl)isoindole-5-carboxamide (CID 52719410) is 2-butyl-1,3-dioxo-N-(5-thiophen-2-yl-1H-pyrazol-3-yl)isoindole-5-carboxamide.
What is the SMILES notation for 2-butyl-1,3-dioxo-N-(5-thiophen-2-yl-1H-pyrazol-3-yl)isoindole-5-carboxamide?
The canonical SMILES for 2-butyl-1,3-dioxo-N-(5-thiophen-2-yl-1H-pyrazol-3-yl)isoindole-5-carboxamide is CCCCN1C(=O)c2ccc(C(=O)Nc3cc(-c4cccs4)[nH]n3)cc2C1=O.
What is the InChIKey of 2-butyl-1,3-dioxo-N-(5-thiophen-2-yl-1H-pyrazol-3-yl)isoindole-5-carboxamide?
The InChIKey is HGUMHEXXETYZHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N4O3S/c1-2-3-8-24-19(26)13-7-6-12(10-14(13)20(24)27)18(25)21-17-11-15(22-23-17)16-5-4-9-28-16/h4-7,9-11H,2-3,8H2,1H3,(H2,21,22,23,25).
What are the key properties of 2-butyl-1,3-dioxo-N-(5-thiophen-2-yl-1H-pyrazol-3-yl)isoindole-5-carboxamide?
2-butyl-1,3-dioxo-N-(5-thiophen-2-yl-1H-pyrazol-3-yl)isoindole-5-carboxamide has a molecular weight of 394.46 g/mol, XLogP of 3.79, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-1,3-dioxo-N-(5-thiophen-2-yl-1H-pyrazol-3-yl)isoindole-5-carboxamide is sourced from PubChem (CID 52719410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).