C18H17N5O3S — CID 55977222
3,5-diacetamido-N-(5-thiophen-2-yl-1H-pyrazol-3-yl)benzamide (PubChem CID 55977222) has the molecular formula C18H17N5O3S and a molecular weight of 383.43 g/mol. Its IUPAC name is 3,5-diacetamido-N-(5-thiophen-2-yl-1H-pyrazol-3-yl)benzamide.
| Compound Name | 3,5-diacetamido-N-(5-thiophen-2-yl-1H-pyrazol-3-yl)benzamide |
|---|---|
| PubChem CID | 55977222 |
| Molecular Formula | C18H17N5O3S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 3,5-diacetamido-N-(5-thiophen-2-yl-1H-pyrazol-3-yl)benzamide |
| SMILES | CC(=O)Nc1cc(NC(C)=O)cc(C(=O)Nc2cc(-c3cccs3)[nH]n2)c1 |
| InChI | InChI=1S/C18H17N5O3S/c1-10(24)19-13-6-12(7-14(8-13)20-11(2)25)18(26)21-17-9-15(22-23-17)16-4-3-5-27-16/h3-9H,1-2H3,(H,19,24)(H,20,25)(H2,21,22,23,26) |
| InChIKey | LBEMXXXTRFSZGW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |