C14H11N5O3S — CID 52719472
4-amino-3-nitro-N-(5-thiophen-2-yl-1H-pyrazol-3-yl)benzamide (PubChem CID 52719472) has the molecular formula C14H11N5O3S and a molecular weight of 329.34 g/mol. Its IUPAC name is 4-amino-3-nitro-N-(5-thiophen-2-yl-1H-pyrazol-3-yl)benzamide.
| Compound Name | 4-amino-3-nitro-N-(5-thiophen-2-yl-1H-pyrazol-3-yl)benzamide |
|---|---|
| PubChem CID | 52719472 |
| Molecular Formula | C14H11N5O3S |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 4-amino-3-nitro-N-(5-thiophen-2-yl-1H-pyrazol-3-yl)benzamide |
| SMILES | Nc1ccc(C(=O)Nc2cc(-c3cccs3)[nH]n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H11N5O3S/c15-9-4-3-8(6-11(9)19(21)22)14(20)16-13-7-10(17-18-13)12-2-1-5-23-12/h1-7H,15H2,(H2,16,17,18,20) |
| InChIKey | BJNRMVKLLJZBPY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 126.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|