C23H25N3O5S — CID 5135886
2-butyl-1,3-dioxo-N-(3-pyrrolidin-1-ylsulfonylphenyl)isoindole-5-carboxamide (PubChem CID 5135886) has the molecular formula C23H25N3O5S and a molecular weight of 455.54 g/mol. Its IUPAC name is 2-butyl-1,3-dioxo-N-(3-pyrrolidin-1-ylsulfonylphenyl)isoindole-5-carboxamide.
| Compound Name | 2-butyl-1,3-dioxo-N-(3-pyrrolidin-1-ylsulfonylphenyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 5135886 |
| Molecular Formula | C23H25N3O5S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 2-butyl-1,3-dioxo-N-(3-pyrrolidin-1-ylsulfonylphenyl)isoindole-5-carboxamide |
| SMILES | CCCCN1C(=O)c2ccc(C(=O)Nc3cccc(S(=O)(=O)N4CCCC4)c3)cc2C1=O |
| InChI | InChI=1S/C23H25N3O5S/c1-2-3-13-26-22(28)19-10-9-16(14-20(19)23(26)29)21(27)24-17-7-6-8-18(15-17)32(30,31)25-11-4-5-12-25/h6-10,14-15H,2-5,11-13H2,1H3,(H,24,27) |
| InChIKey | KYUBHEDIIPNSIY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|