C24H24F3N3O4 — CID 55643230
2-butyl-N-[3-[[ethyl-(2,2,2-trifluoroacetyl)amino]methyl]phenyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 55643230) has the molecular formula C24H24F3N3O4 and a molecular weight of 475.47 g/mol. Its IUPAC name is 2-butyl-N-[3-[[ethyl-(2,2,2-trifluoroacetyl)amino]methyl]phenyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-butyl-N-[3-[[ethyl-(2,2,2-trifluoroacetyl)amino]methyl]phenyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 55643230 |
| Molecular Formula | C24H24F3N3O4 |
| Molecular Weight | 475.47 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 2-butyl-N-[3-[[ethyl-(2,2,2-trifluoroacetyl)amino]methyl]phenyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CCCCN1C(=O)c2ccc(C(=O)Nc3cccc(CN(CC)C(=O)C(F)(F)F)c3)cc2C1=O |
| InChI | InChI=1S/C24H24F3N3O4/c1-3-5-11-30-21(32)18-10-9-16(13-19(18)22(30)33)20(31)28-17-8-6-7-15(12-17)14-29(4-2)23(34)24(25,26)27/h6-10,12-13H,3-5,11,14H2,1-2H3,(H,28,31) |
| InChIKey | HEGATLXTRSABTR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|