C16H14F3N3O4S — CID 47047150
N-[3-[[ethyl-(2,2,2-trifluoroacetyl)amino]methyl]phenyl]-5-nitrothiophene-3-carboxamide (PubChem CID 47047150) has the molecular formula C16H14F3N3O4S and a molecular weight of 401.37 g/mol. Its IUPAC name is N-[3-[[ethyl-(2,2,2-trifluoroacetyl)amino]methyl]phenyl]-5-nitrothiophene-3-carboxamide.
| Compound Name | N-[3-[[ethyl-(2,2,2-trifluoroacetyl)amino]methyl]phenyl]-5-nitrothiophene-3-carboxamide |
|---|---|
| PubChem CID | 47047150 |
| Molecular Formula | C16H14F3N3O4S |
| Molecular Weight | 401.37 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | N-[3-[[ethyl-(2,2,2-trifluoroacetyl)amino]methyl]phenyl]-5-nitrothiophene-3-carboxamide |
| SMILES | CCN(Cc1cccc(NC(=O)c2csc([N+](=O)[O-])c2)c1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C16H14F3N3O4S/c1-2-21(15(24)16(17,18)19)8-10-4-3-5-12(6-10)20-14(23)11-7-13(22(25)26)27-9-11/h3-7,9H,2,8H2,1H3,(H,20,23) |
| InChIKey | TVSWLMQHULPNMD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|