C20H17F3N4O6 — CID 55671461
N-ethyl-2,2,2-trifluoro-N-[[3-[[2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetyl]amino]phenyl]methyl]acetamide (PubChem CID 55671461) has the molecular formula C20H17F3N4O6 and a molecular weight of 466.37 g/mol. Its IUPAC name is N-ethyl-2,2,2-trifluoro-N-[[3-[[2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetyl]amino]phenyl]methyl]acetamide.
| Compound Name | N-ethyl-2,2,2-trifluoro-N-[[3-[[2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetyl]amino]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 55671461 |
| Molecular Formula | C20H17F3N4O6 |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | N-ethyl-2,2,2-trifluoro-N-[[3-[[2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetyl]amino]phenyl]methyl]acetamide |
| SMILES | CCN(Cc1cccc(NC(=O)Cn2c(=O)oc3cc([N+](=O)[O-])ccc32)c1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C20H17F3N4O6/c1-2-25(18(29)20(21,22)23)10-12-4-3-5-13(8-12)24-17(28)11-26-15-7-6-14(27(31)32)9-16(15)33-19(26)30/h3-9H,2,10-11H2,1H3,(H,24,28) |
| InChIKey | FGTHHSRBKVIZQK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 127.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|