C15H9F2N3O5 — CID 9408977
N-(2,4-difluorophenyl)-2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetamide (PubChem CID 9408977) has the molecular formula C15H9F2N3O5 and a molecular weight of 349.25 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetamide.
| Compound Name | N-(2,4-difluorophenyl)-2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 9408977 |
| Molecular Formula | C15H9F2N3O5 |
| Molecular Weight | 349.25 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetamide |
| SMILES | O=C(Cn1c(=O)oc2cc([N+](=O)[O-])ccc21)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C15H9F2N3O5/c16-8-1-3-11(10(17)5-8)18-14(21)7-19-12-4-2-9(20(23)24)6-13(12)25-15(19)22/h1-6H,7H2,(H,18,21) |
| InChIKey | IDPALKQASOWNRQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|