C17H13F2N3O5 — CID 55364480
N-[1-(2,4-difluorophenyl)ethyl]-2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetamide (PubChem CID 55364480) has the molecular formula C17H13F2N3O5 and a molecular weight of 377.30 g/mol. Its IUPAC name is N-[1-(2,4-difluorophenyl)ethyl]-2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetamide.
| Compound Name | N-[1-(2,4-difluorophenyl)ethyl]-2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 55364480 |
| Molecular Formula | C17H13F2N3O5 |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | N-[1-(2,4-difluorophenyl)ethyl]-2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetamide |
| SMILES | CC(NC(=O)Cn1c(=O)oc2cc([N+](=O)[O-])ccc21)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H13F2N3O5/c1-9(12-4-2-10(18)6-13(12)19)20-16(23)8-21-14-5-3-11(22(25)26)7-15(14)27-17(21)24/h2-7,9H,8H2,1H3,(H,20,23) |
| InChIKey | SVALQRBNYSIQCQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|